C22H20ClN5O5 — CID 19659864
[2-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate (PubChem CID 19659864) has the molecular formula C22H20ClN5O5 and a molecular weight of 469.89 g/mol. Its IUPAC name is [2-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 19659864 |
| Molecular Formula | C22H20ClN5O5 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [2-[(E)-N-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate |
| SMILES | C/C(=N\NC(=O)Cn1nc(C)c([N+](=O)[O-])c1C)c1ccccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN5O5/c1-13(24-25-20(29)12-27-15(3)21(28(31)32)14(2)26-27)18-6-4-5-7-19(18)33-22(30)16-8-10-17(23)11-9-16/h4-11H,12H2,1-3H3,(H,25,29)/b24-13+ |
| InChIKey | GDHJSTFHVFFSHU-ZMOGYAJESA-N |
| XLogP | 3.82 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|