C24H19ClN4O5 — CID 19659512
[2-[(E)-N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate (PubChem CID 19659512) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is [2-[(E)-N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-[(E)-N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 19659512 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | [2-[(E)-N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccc(C(N)=O)cc1)c1ccccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN4O5/c1-14(28-29-23(32)22(31)27-18-12-8-15(9-13-18)21(26)30)19-4-2-3-5-20(19)34-24(33)16-6-10-17(25)11-7-16/h2-13H,1H3,(H2,26,30)(H,27,31)(H,29,32)/b28-14+ |
| InChIKey | RBCFIEYKBHVEEU-CCVNUDIWSA-N |
| XLogP | 3.14 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|