C21H16ClN3O5 — CID 3407616
[2-[N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] furan-2-carboxylate (PubChem CID 3407616) has the molecular formula C21H16ClN3O5 and a molecular weight of 425.83 g/mol. Its IUPAC name is [2-[N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-[N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3407616 |
| Molecular Formula | C21H16ClN3O5 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | [2-[N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] furan-2-carboxylate |
| SMILES | CC(=NNC(=O)C(=O)Nc1ccc(Cl)cc1)c1ccccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H16ClN3O5/c1-13(24-25-20(27)19(26)23-15-10-8-14(22)9-11-15)16-5-2-3-6-17(16)30-21(28)18-7-4-12-29-18/h2-12H,1H3,(H,23,26)(H,25,27) |
| InChIKey | WDKUWOHUCRSMJS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|