C26H20ClN3O3 — CID 4062894
[2-[C-methyl-N-[(4-pyrrol-1-ylbenzoyl)amino]carbonimidoyl]phenyl] 4-chlorobenzoate (PubChem CID 4062894) has the molecular formula C26H20ClN3O3 and a molecular weight of 457.92 g/mol. Its IUPAC name is [2-[C-methyl-N-[(4-pyrrol-1-ylbenzoyl)amino]carbonimidoyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-[C-methyl-N-[(4-pyrrol-1-ylbenzoyl)amino]carbonimidoyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4062894 |
| Molecular Formula | C26H20ClN3O3 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [2-[C-methyl-N-[(4-pyrrol-1-ylbenzoyl)amino]carbonimidoyl]phenyl] 4-chlorobenzoate |
| SMILES | CC(=NNC(=O)c1ccc(-n2cccc2)cc1)c1ccccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClN3O3/c1-18(28-29-25(31)19-10-14-22(15-11-19)30-16-4-5-17-30)23-6-2-3-7-24(23)33-26(32)20-8-12-21(27)13-9-20/h2-17H,1H3,(H,29,31) |
| InChIKey | ILNBBJGHZUZRDM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|