C16H19FN4O4 — CID 17429042
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide (PubChem CID 17429042) has the molecular formula C16H19FN4O4 and a molecular weight of 350.35 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 17429042 |
| Molecular Formula | C16H19FN4O4 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)NC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)cc1F |
| InChI | InChI=1S/C16H19FN4O4/c1-9(12-5-6-14(25-4)13(17)7-12)18-15(22)8-20-11(3)16(21(23)24)10(2)19-20/h5-7,9H,8H2,1-4H3,(H,18,22) |
| InChIKey | JBPIMKOETSQHNW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|