C15H19N5O5S — CID 41041009
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 41041009) has the molecular formula C15H19N5O5S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 41041009 |
| Molecular Formula | C15H19N5O5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | Cc1nn(CC(=O)N[C@H](C)c2ccc(S(N)(=O)=O)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N5O5S/c1-9(12-4-6-13(7-5-12)26(16,24)25)17-14(21)8-19-11(3)15(20(22)23)10(2)18-19/h4-7,9H,8H2,1-3H3,(H,17,21)(H2,16,24,25)/t9-/m1/s1 |
| InChIKey | BRJHRHIDDJIXEH-SECBINFHSA-N |
| XLogP | 0.93 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|