C10H14N4O6 — CID 61152462
(2S)-2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 61152462) has the molecular formula C10H14N4O6 and a molecular weight of 286.24 g/mol. Its IUPAC name is (2S)-2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61152462 |
| Molecular Formula | C10H14N4O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (2S)-2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | Cc1nn(CC(=O)N[C@@H](CO)C(=O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O6/c1-5-9(14(19)20)6(2)13(12-5)3-8(16)11-7(4-15)10(17)18/h7,15H,3-4H2,1-2H3,(H,11,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | XGDMPJYDAVTBNU-ZETCQYMHSA-N |
| XLogP | -1.03 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|