C7H8ClN3O3 — CID 83813704
2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl chloride (PubChem CID 83813704) has the molecular formula C7H8ClN3O3 and a molecular weight of 217.61 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl chloride.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl chloride |
|---|---|
| PubChem CID | 83813704 |
| Molecular Formula | C7H8ClN3O3 |
| Molecular Weight | 217.61 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl chloride |
| SMILES | Cc1nn(CC(=O)Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8ClN3O3/c1-4-7(11(13)14)5(2)10(9-4)3-6(8)12/h3H2,1-2H3 |
| InChIKey | UXVOJUXUBJDFFK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.61 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|