C7H11N5O3 — CID 51852290
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N'-hydroxyethanimidamide (PubChem CID 51852290) has the molecular formula C7H11N5O3 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 51852290 |
| Molecular Formula | C7H11N5O3 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N'-hydroxyethanimidamide |
| SMILES | Cc1nn(C/C(N)=N\O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N5O3/c1-4-7(12(14)15)5(2)11(9-4)3-6(8)10-13/h13H,3H2,1-2H3,(H2,8,10) |
| InChIKey | QKRUZYYYDZTVJM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|