C14H13Cl2N5O4 — CID 19292128
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 19292128) has the molecular formula C14H13Cl2N5O4 and a molecular weight of 386.20 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 19292128 |
| Molecular Formula | C14H13Cl2N5O4 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)O/N=C(\N)c2ccc(Cl)cc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13Cl2N5O4/c1-7-13(21(23)24)8(2)20(18-7)6-12(22)25-19-14(17)10-4-3-9(15)5-11(10)16/h3-5H,6H2,1-2H3,(H2,17,19) |
| InChIKey | BJRHBDYOZZFCDR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|