C15H11Cl2N3O4 — CID 19292107
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 4-methyl-3-nitrobenzoate (PubChem CID 19292107) has the molecular formula C15H11Cl2N3O4 and a molecular weight of 368.18 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 4-methyl-3-nitrobenzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 19292107 |
| Molecular Formula | C15H11Cl2N3O4 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C(\N)c2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11Cl2N3O4/c1-8-2-3-9(6-13(8)20(22)23)15(21)24-19-14(18)11-5-4-10(16)7-12(11)17/h2-7H,1H3,(H2,18,19) |
| InChIKey | HQUYRBHNORZSEW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|