C18H18Cl2N2O4 — CID 19292090
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-diethoxybenzoate (PubChem CID 19292090) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-diethoxybenzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 19292090 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)O/N=C(\N)c2ccc(Cl)cc2Cl)cc1OCC |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-3-24-15-8-5-11(9-16(15)25-4-2)18(23)26-22-17(21)13-7-6-12(19)10-14(13)20/h5-10H,3-4H2,1-2H3,(H2,21,22) |
| InChIKey | YLVULWXGMHJMDX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|