C17H16Cl2N2O5 — CID 19293785
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,3,4-trimethoxybenzoate (PubChem CID 19293785) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,3,4-trimethoxybenzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 19293785 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O/N=C(\N)c2ccc(Cl)cc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-23-13-7-6-11(14(24-2)15(13)25-3)17(22)26-21-16(20)10-5-4-9(18)8-12(10)19/h4-8H,1-3H3,(H2,20,21) |
| InChIKey | LXANOHITYULGRV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|