C14H9Cl2N3O4 — CID 2937034
[[amino-(2,4-dichlorophenyl)methylidene]amino] 4-nitrobenzoate (PubChem CID 2937034) has the molecular formula C14H9Cl2N3O4 and a molecular weight of 354.15 g/mol. Its IUPAC name is [[amino-(2,4-dichlorophenyl)methylidene]amino] 4-nitrobenzoate.
| Compound Name | [[amino-(2,4-dichlorophenyl)methylidene]amino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 2937034 |
| Molecular Formula | C14H9Cl2N3O4 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | [[amino-(2,4-dichlorophenyl)methylidene]amino] 4-nitrobenzoate |
| SMILES | NC(=NOC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N3O4/c15-9-3-6-11(12(16)7-9)13(17)18-23-14(20)8-1-4-10(5-2-8)19(21)22/h1-7H,(H2,17,18) |
| InChIKey | QUPPYEPFIWLAMR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|