C14H8Cl2N2O4 — CID 6025983
[(Z)-(2,4-dichlorophenyl)methylideneamino] 4-nitrobenzoate (PubChem CID 6025983) has the molecular formula C14H8Cl2N2O4 and a molecular weight of 339.13 g/mol. Its IUPAC name is [(Z)-(2,4-dichlorophenyl)methylideneamino] 4-nitrobenzoate.
| Compound Name | [(Z)-(2,4-dichlorophenyl)methylideneamino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6025983 |
| Molecular Formula | C14H8Cl2N2O4 |
| Molecular Weight | 339.13 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | [(Z)-(2,4-dichlorophenyl)methylideneamino] 4-nitrobenzoate |
| SMILES | O=C(O/N=C\c1ccc(Cl)cc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H8Cl2N2O4/c15-11-4-1-10(13(16)7-11)8-17-22-14(19)9-2-5-12(6-3-9)18(20)21/h1-8H/b17-8- |
| InChIKey | LXILGMXRNYBFQK-IUXPMGMMSA-N |
| XLogP | 4.09 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|