C13H7BrCl2N2O2 — CID 633064
N-(2-bromo-4-nitrophenyl)-1-(2,4-dichlorophenyl)methanimine (PubChem CID 633064) has the molecular formula C13H7BrCl2N2O2 and a molecular weight of 374.02 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-1-(2,4-dichlorophenyl)methanimine.
| Compound Name | N-(2-bromo-4-nitrophenyl)-1-(2,4-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 633064 |
| Molecular Formula | C13H7BrCl2N2O2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-1-(2,4-dichlorophenyl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(/N=C/c2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C13H7BrCl2N2O2/c14-11-6-10(18(19)20)3-4-13(11)17-7-8-1-2-9(15)5-12(8)16/h1-7H/b17-7+ |
| InChIKey | BZGLIVDTVZDRRD-REZTVBANSA-N |
| XLogP | 5.41 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|