C13H8Cl2N2O3 — CID 690802
2-[(2,5-dichlorophenyl)iminomethyl]-4-nitrophenol (PubChem CID 690802) has the molecular formula C13H8Cl2N2O3 and a molecular weight of 311.12 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)iminomethyl]-4-nitrophenol.
| Compound Name | 2-[(2,5-dichlorophenyl)iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 690802 |
| Molecular Formula | C13H8Cl2N2O3 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)iminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O3/c14-9-1-3-11(15)12(6-9)16-7-8-5-10(17(19)20)2-4-13(8)18/h1-7,18H/b16-7+ |
| InChIKey | NRYGGDFYIUQXKM-FRKPEAEDSA-N |
| XLogP | 4.36 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|