C13H8Cl3N3O3 — CID 135514277
4-nitro-2-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135514277) has the molecular formula C13H8Cl3N3O3 and a molecular weight of 360.58 g/mol. Its IUPAC name is 4-nitro-2-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-nitro-2-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135514277 |
| Molecular Formula | C13H8Cl3N3O3 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 4-nitro-2-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/Nc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H8Cl3N3O3/c14-8-4-10(15)13(11(16)5-8)18-17-6-7-3-9(19(21)22)1-2-12(7)20/h1-6,18,20H/b17-6+ |
| InChIKey | YPBUWTWKCNBCRV-UBKPWBPPSA-N |
| XLogP | 4.71 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|