C13H8BrCl3N2O — CID 136705021
4-bromo-2-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 136705021) has the molecular formula C13H8BrCl3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136705021 |
| Molecular Formula | C13H8BrCl3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 4-bromo-2-[(Z)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N\Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8BrCl3N2O/c14-8-1-2-12(20)7(3-8)6-18-19-13-10(16)4-9(15)5-11(13)17/h1-6,19-20H/b18-6- |
| InChIKey | UTPRIMKEZHMSFA-FXBPXSCXSA-N |
| XLogP | 5.56 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|