C13H7Br2Cl3N2O — CID 135717168
2,4-dibromo-6-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135717168) has the molecular formula C13H7Br2Cl3N2O and a molecular weight of 473.38 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135717168 |
| Molecular Formula | C13H7Br2Cl3N2O |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 469.80 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Br2Cl3N2O/c14-7-1-6(13(21)9(15)2-7)5-19-20-12-10(17)3-8(16)4-11(12)18/h1-5,20-21H/b19-5+ |
| InChIKey | VBWFWBTWJMGRCD-PTXOJBNSSA-N |
| XLogP | 6.32 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|