C14H8Br4N2O2 — CID 135459439
2,4-dibromo-6-[(E)-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]methyl]phenol (PubChem CID 135459439) has the molecular formula C14H8Br4N2O2 and a molecular weight of 555.85 g/mol. Its IUPAC name is 2,4-dibromo-6-[(E)-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[(E)-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135459439 |
| Molecular Formula | C14H8Br4N2O2 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 551.73 |
| IUPAC Name | 2,4-dibromo-6-[(E)-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylidenehydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H8Br4N2O2/c15-9-1-7(13(21)11(17)3-9)5-19-20-6-8-2-10(16)4-12(18)14(8)22/h1-6,21-22H/b19-5+,20-6+ |
| InChIKey | KGBGZCIYGGUQKO-OGBZJDJUSA-N |
| XLogP | 5.60 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|