C13H8Br3NO — CID 1286585
2,4-dibromo-6-[(3-bromophenyl)iminomethyl]phenol (PubChem CID 1286585) has the molecular formula C13H8Br3NO and a molecular weight of 433.93 g/mol. Its IUPAC name is 2,4-dibromo-6-[(3-bromophenyl)iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(3-bromophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 1286585 |
| Molecular Formula | C13H8Br3NO |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 430.82 |
| IUPAC Name | 2,4-dibromo-6-[(3-bromophenyl)iminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1cccc(Br)c1 |
| InChI | InChI=1S/C13H8Br3NO/c14-9-2-1-3-11(5-9)17-7-8-4-10(15)6-12(16)13(8)18/h1-7,18H/b17-7+ |
| InChIKey | KAKDXCHSIBMPGM-REZTVBANSA-N |
| XLogP | 5.43 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|