C20H13Br2ClN2O3 — CID 143730123
2-chloro-N-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]-4-hydroxybenzamide (PubChem CID 143730123) has the molecular formula C20H13Br2ClN2O3 and a molecular weight of 524.60 g/mol. Its IUPAC name is 2-chloro-N-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]-4-hydroxybenzamide.
| Compound Name | 2-chloro-N-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 143730123 |
| Molecular Formula | C20H13Br2ClN2O3 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 521.90 |
| IUPAC Name | 2-chloro-N-[3-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]-4-hydroxybenzamide |
| SMILES | O=C(Nc1cccc(/N=C/c2cc(Br)cc(Br)c2O)c1)c1ccc(O)cc1Cl |
| InChI | InChI=1S/C20H13Br2ClN2O3/c21-12-6-11(19(27)17(22)7-12)10-24-13-2-1-3-14(8-13)25-20(28)16-5-4-15(26)9-18(16)23/h1-10,26-27H,(H,25,28)/b24-10+ |
| InChIKey | IOCSWMLZIOHYFW-YSURURNPSA-N |
| XLogP | 6.28 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|