C27H18BrCl3N2O2 — CID 135901021
N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]-2,4-dichlorobenzamide (PubChem CID 135901021) has the molecular formula C27H18BrCl3N2O2 and a molecular weight of 588.72 g/mol. Its IUPAC name is N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 135901021 |
| Molecular Formula | C27H18BrCl3N2O2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 585.96 |
| IUPAC Name | N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1cccc(/N=C/c2cc(Cc3ccccc3Cl)cc(Br)c2O)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H18BrCl3N2O2/c28-23-12-16(10-17-4-1-2-7-24(17)30)11-18(26(23)34)15-32-20-5-3-6-21(14-20)33-27(35)22-9-8-19(29)13-25(22)31/h1-9,11-15,34H,10H2,(H,33,35)/b32-15+ |
| InChIKey | YXHUYRRFJIBZIH-VWJSQJICSA-N |
| XLogP | 8.71 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|