C23H20BrClN2O2 — CID 4160765
N-[4-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]propanamide (PubChem CID 4160765) has the molecular formula C23H20BrClN2O2 and a molecular weight of 471.78 g/mol. Its IUPAC name is N-[4-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]propanamide.
| Compound Name | N-[4-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]propanamide |
|---|---|
| PubChem CID | 4160765 |
| Molecular Formula | C23H20BrClN2O2 |
| Molecular Weight | 471.78 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N-[4-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(/N=C/c2cc(Cc3ccccc3Cl)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C23H20BrClN2O2/c1-2-22(28)27-19-9-7-18(8-10-19)26-14-17-12-15(13-20(24)23(17)29)11-16-5-3-4-6-21(16)25/h3-10,12-14,29H,2,11H2,1H3,(H,27,28)/b26-14+ |
| InChIKey | XMSYNZDKJKDZNA-VULFUBBASA-N |
| XLogP | 6.50 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.78 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|