C24H22BrClN2O2 — CID 4508385
N-[3-[(5-benzyl-3-bromo-2-hydroxyphenyl)methylideneamino]-4-chlorophenyl]butanamide (PubChem CID 4508385) has the molecular formula C24H22BrClN2O2 and a molecular weight of 485.81 g/mol. Its IUPAC name is N-[3-[(5-benzyl-3-bromo-2-hydroxyphenyl)methylideneamino]-4-chlorophenyl]butanamide.
| Compound Name | N-[3-[(5-benzyl-3-bromo-2-hydroxyphenyl)methylideneamino]-4-chlorophenyl]butanamide |
|---|---|
| PubChem CID | 4508385 |
| Molecular Formula | C24H22BrClN2O2 |
| Molecular Weight | 485.81 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-[3-[(5-benzyl-3-bromo-2-hydroxyphenyl)methylideneamino]-4-chlorophenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(/N=C/c2cc(Cc3ccccc3)cc(Br)c2O)c1 |
| InChI | InChI=1S/C24H22BrClN2O2/c1-2-6-23(29)28-19-9-10-21(26)22(14-19)27-15-18-12-17(13-20(25)24(18)30)11-16-7-4-3-5-8-16/h3-5,7-10,12-15,30H,2,6,11H2,1H3,(H,28,29)/b27-15+ |
| InChIKey | YWJCPCGYHGYXLA-JFLMPSFJSA-N |
| XLogP | 6.89 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.81 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|