C17H15ClI2N2O2 — CID 4508173
N-[4-chloro-3-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]phenyl]butanamide (PubChem CID 4508173) has the molecular formula C17H15ClI2N2O2 and a molecular weight of 568.58 g/mol. Its IUPAC name is N-[4-chloro-3-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]phenyl]butanamide.
| Compound Name | N-[4-chloro-3-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]phenyl]butanamide |
|---|---|
| PubChem CID | 4508173 |
| Molecular Formula | C17H15ClI2N2O2 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 567.89 |
| IUPAC Name | N-[4-chloro-3-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(/N=C/c2cc(I)cc(I)c2O)c1 |
| InChI | InChI=1S/C17H15ClI2N2O2/c1-2-3-16(23)22-12-4-5-13(18)15(8-12)21-9-10-6-11(19)7-14(20)17(10)24/h4-9,24H,2-3H2,1H3,(H,22,23)/b21-9+ |
| InChIKey | PLGSREWAYXUOJD-ZVBGSRNCSA-N |
| XLogP | 5.74 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|