C19H14I2N2O — CID 171981187
2-[(4-anilinophenyl)iminomethyl]-4,6-diiodophenol (PubChem CID 171981187) has the molecular formula C19H14I2N2O and a molecular weight of 540.14 g/mol. Its IUPAC name is 2-[(4-anilinophenyl)iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[(4-anilinophenyl)iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 171981187 |
| Molecular Formula | C19H14I2N2O |
| Molecular Weight | 540.14 g/mol |
| Exact Mass | 539.92 |
| IUPAC Name | 2-[(4-anilinophenyl)iminomethyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H14I2N2O/c20-14-10-13(19(24)18(21)11-14)12-22-15-6-8-17(9-7-15)23-16-4-2-1-3-5-16/h1-12,23-24H/b22-12+ |
| InChIKey | YYFRXFDVPOANSJ-WSDLNYQXSA-N |
| XLogP | 6.10 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.14 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|