C19H13I2NO2 — CID 3915695
2-[(2-hydroxy-5-phenylphenyl)iminomethyl]-4,6-diiodophenol (PubChem CID 3915695) has the molecular formula C19H13I2NO2 and a molecular weight of 541.13 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-phenylphenyl)iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[(2-hydroxy-5-phenylphenyl)iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 3915695 |
| Molecular Formula | C19H13I2NO2 |
| Molecular Weight | 541.13 g/mol |
| Exact Mass | 540.90 |
| IUPAC Name | 2-[(2-hydroxy-5-phenylphenyl)iminomethyl]-4,6-diiodophenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1/N=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C19H13I2NO2/c20-15-8-14(19(24)16(21)10-15)11-22-17-9-13(6-7-18(17)23)12-4-2-1-3-5-12/h1-11,23-24H/b22-11+ |
| InChIKey | SDFPITRRLRXYHA-SSDVNMTOSA-N |
| XLogP | 5.72 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.13 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|