C19H13Cl2NO — CID 4059115
2-[(2,4-dichlorophenyl)methylideneamino]-4-phenylphenol (PubChem CID 4059115) has the molecular formula C19H13Cl2NO and a molecular weight of 342.23 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylideneamino]-4-phenylphenol.
| Compound Name | 2-[(2,4-dichlorophenyl)methylideneamino]-4-phenylphenol |
|---|---|
| PubChem CID | 4059115 |
| Molecular Formula | C19H13Cl2NO |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylideneamino]-4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl2NO/c20-16-8-6-15(17(21)11-16)12-22-18-10-14(7-9-19(18)23)13-4-2-1-3-5-13/h1-12,23H/b22-12+ |
| InChIKey | TUZREUGEWADMPZ-WSDLNYQXSA-N |
| XLogP | 6.12 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|