C12H10Cl2O2 — CID 67451432
2,4-dichlorophenol;phenol (PubChem CID 67451432) has the molecular formula C12H10Cl2O2 and a molecular weight of 257.12 g/mol. Its IUPAC name is 2,4-dichlorophenol;phenol.
| Compound Name | 2,4-dichlorophenol;phenol |
|---|---|
| PubChem CID | 67451432 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2,4-dichlorophenol;phenol |
| SMILES | Oc1ccc(Cl)cc1Cl.Oc1ccccc1 |
| InChI | InChI=1S/C6H4Cl2O.C6H6O/c7-4-1-2-6(9)5(8)3-4;7-6-4-2-1-3-5-6/h1-3,9H;1-5,7H |
| InChIKey | ZVDKAYAWVKTPBZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |