C12H7Cl5O — CID 159935544
1,2,3,4,5-pentachlorobenzene;phenol (PubChem CID 159935544) has the molecular formula C12H7Cl5O and a molecular weight of 344.45 g/mol. Its IUPAC name is 1,2,3,4,5-pentachlorobenzene;phenol.
| Compound Name | 1,2,3,4,5-pentachlorobenzene;phenol |
|---|---|
| PubChem CID | 159935544 |
| Molecular Formula | C12H7Cl5O |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | 1,2,3,4,5-pentachlorobenzene;phenol |
| SMILES | Clc1cc(Cl)c(Cl)c(Cl)c1Cl.Oc1ccccc1 |
| InChI | InChI=1S/C6HCl5.C6H6O/c7-2-1-3(8)5(10)6(11)4(2)9;7-6-4-2-1-3-5-6/h1H;1-5,7H |
| InChIKey | OAEXPGQVOUEDAC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|