C12H9Cl3O2 — CID 172810083
phenol;2,3,5-trichlorophenol (PubChem CID 172810083) has the molecular formula C12H9Cl3O2 and a molecular weight of 291.56 g/mol. Its IUPAC name is phenol;2,3,5-trichlorophenol.
| Compound Name | phenol;2,3,5-trichlorophenol |
|---|---|
| PubChem CID | 172810083 |
| Molecular Formula | C12H9Cl3O2 |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | phenol;2,3,5-trichlorophenol |
| SMILES | Oc1cc(Cl)cc(Cl)c1Cl.Oc1ccccc1 |
| InChI | InChI=1S/C6H3Cl3O.C6H6O/c7-3-1-4(8)6(9)5(10)2-3;7-6-4-2-1-3-5-6/h1-2,10H;1-5,7H |
| InChIKey | SAZZHCIQETZZTC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|