About benzene;4-chloro-3,5-dimethylphenol;phenol
benzene;4-chloro-3,5-dimethylphenol;phenol (PubChem CID 174934171) has the molecular formula C20H21ClO2
and a molecular weight of 328.84 g/mol. Its IUPAC name is benzene;4-chloro-3,5-dimethylphenol;phenol.
Molecular Properties
| Compound Name | benzene;4-chloro-3,5-dimethylphenol;phenol |
| PubChem CID | 174934171 |
| Molecular Formula | C20H21ClO2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | benzene;4-chloro-3,5-dimethylphenol;phenol |
| SMILES | Cc1cc(O)cc(C)c1Cl.Oc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C8H9ClO.C6H6O.C6H6/c1-5-3-7(10)4-6(2)8(5)9;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h3-4,10H,1-2H3;1-5,7H;1-6H |
| InChIKey | GOUDJLKFTMHFPO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;4-chloro-3,5-dimethylphenol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-chloro-3,5-dimethylphenol;phenol?
The IUPAC name of benzene;4-chloro-3,5-dimethylphenol;phenol (CID 174934171) is benzene;4-chloro-3,5-dimethylphenol;phenol.
What is the SMILES notation for benzene;4-chloro-3,5-dimethylphenol;phenol?
The canonical SMILES for benzene;4-chloro-3,5-dimethylphenol;phenol is Cc1cc(O)cc(C)c1Cl.Oc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;4-chloro-3,5-dimethylphenol;phenol?
The InChIKey is GOUDJLKFTMHFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO.C6H6O.C6H6/c1-5-3-7(10)4-6(2)8(5)9;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h3-4,10H,1-2H3;1-5,7H;1-6H.
What are the key properties of benzene;4-chloro-3,5-dimethylphenol;phenol?
benzene;4-chloro-3,5-dimethylphenol;phenol has a molecular weight of 328.84 g/mol, XLogP of 5.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-chloro-3,5-dimethylphenol;phenol is sourced from PubChem (CID 174934171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).