About 1-chloro-3,5-dimethylbenzene;phenol
1-chloro-3,5-dimethylbenzene;phenol (PubChem CID 158089638) has the molecular formula C14H15ClO
and a molecular weight of 234.73 g/mol. Its IUPAC name is 1-chloro-3,5-dimethylbenzene;phenol.
Molecular Properties
| Compound Name | 1-chloro-3,5-dimethylbenzene;phenol |
| PubChem CID | 158089638 |
| Molecular Formula | C14H15ClO |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-chloro-3,5-dimethylbenzene;phenol |
| SMILES | Cc1cc(C)cc(Cl)c1.Oc1ccccc1 |
| InChI | InChI=1S/C8H9Cl.C6H6O/c1-6-3-7(2)5-8(9)4-6;7-6-4-2-1-3-5-6/h3-5H,1-2H3;1-5,7H |
| InChIKey | FNYBXOMXWMDPPW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-3,5-dimethylbenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,5-dimethylbenzene;phenol?
The IUPAC name of 1-chloro-3,5-dimethylbenzene;phenol (CID 158089638) is 1-chloro-3,5-dimethylbenzene;phenol.
What is the SMILES notation for 1-chloro-3,5-dimethylbenzene;phenol?
The canonical SMILES for 1-chloro-3,5-dimethylbenzene;phenol is Cc1cc(C)cc(Cl)c1.Oc1ccccc1.
What is the InChIKey of 1-chloro-3,5-dimethylbenzene;phenol?
The InChIKey is FNYBXOMXWMDPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl.C6H6O/c1-6-3-7(2)5-8(9)4-6;7-6-4-2-1-3-5-6/h3-5H,1-2H3;1-5,7H.
What are the key properties of 1-chloro-3,5-dimethylbenzene;phenol?
1-chloro-3,5-dimethylbenzene;phenol has a molecular weight of 234.73 g/mol, XLogP of 4.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,5-dimethylbenzene;phenol is sourced from PubChem (CID 158089638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).