C15H17Cl — CID 160520225
chlorobenzene;1,3,5-trimethylbenzene (PubChem CID 160520225) has the molecular formula C15H17Cl and a molecular weight of 232.75 g/mol. Its IUPAC name is chlorobenzene;1,3,5-trimethylbenzene.
| Compound Name | chlorobenzene;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 160520225 |
| Molecular Formula | C15H17Cl |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | chlorobenzene;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.Clc1ccccc1 |
| InChI | InChI=1S/C9H12.C6H5Cl/c1-7-4-8(2)6-9(3)5-7;7-6-4-2-1-3-5-6/h4-6H,1-3H3;1-5H |
| InChIKey | QUEFAAGGLBXBHW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |