About 1,3-dichloro-5-methylbenzene;toluene
1,3-dichloro-5-methylbenzene;toluene (PubChem CID 143933195) has the molecular formula C14H14Cl2
and a molecular weight of 253.17 g/mol. Its IUPAC name is 1,3-dichloro-5-methylbenzene;toluene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-methylbenzene;toluene |
| PubChem CID | 143933195 |
| Molecular Formula | C14H14Cl2 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1,3-dichloro-5-methylbenzene;toluene |
| SMILES | Cc1cc(Cl)cc(Cl)c1.Cc1ccccc1 |
| InChI | InChI=1S/C7H6Cl2.C7H8/c1-5-2-6(8)4-7(9)3-5;1-7-5-3-2-4-6-7/h2-4H,1H3;2-6H,1H3 |
| InChIKey | ZGWQPXGUYAERQN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dichloro-5-methylbenzene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-methylbenzene;toluene?
The IUPAC name of 1,3-dichloro-5-methylbenzene;toluene (CID 143933195) is 1,3-dichloro-5-methylbenzene;toluene.
What is the SMILES notation for 1,3-dichloro-5-methylbenzene;toluene?
The canonical SMILES for 1,3-dichloro-5-methylbenzene;toluene is Cc1cc(Cl)cc(Cl)c1.Cc1ccccc1.
What is the InChIKey of 1,3-dichloro-5-methylbenzene;toluene?
The InChIKey is ZGWQPXGUYAERQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2.C7H8/c1-5-2-6(8)4-7(9)3-5;1-7-5-3-2-4-6-7/h2-4H,1H3;2-6H,1H3.
What are the key properties of 1,3-dichloro-5-methylbenzene;toluene?
1,3-dichloro-5-methylbenzene;toluene has a molecular weight of 253.17 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-methylbenzene;toluene is sourced from PubChem (CID 143933195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).