C12H11ClO4 — CID 22153361
benzene-1,2-diol;4-chlorobenzene-1,2-diol (PubChem CID 22153361) has the molecular formula C12H11ClO4 and a molecular weight of 254.67 g/mol. Its IUPAC name is benzene-1,2-diol;4-chlorobenzene-1,2-diol.
| Compound Name | benzene-1,2-diol;4-chlorobenzene-1,2-diol |
|---|---|
| PubChem CID | 22153361 |
| Molecular Formula | C12H11ClO4 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | benzene-1,2-diol;4-chlorobenzene-1,2-diol |
| SMILES | Oc1ccc(Cl)cc1O.Oc1ccccc1O |
| InChI | InChI=1S/C6H5ClO2.C6H6O2/c7-4-1-2-5(8)6(9)3-4;7-5-3-1-2-4-6(5)8/h1-3,8-9H;1-4,7-8H |
| InChIKey | GLWQZYROBSOYKD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|