About 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol
1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol (PubChem CID 175369538) has the molecular formula C12H8Br2Cl2O
and a molecular weight of 398.91 g/mol. Its IUPAC name is 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol.
Molecular Properties
| Compound Name | 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol |
| PubChem CID | 175369538 |
| Molecular Formula | C12H8Br2Cl2O |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 395.83 |
| IUPAC Name | 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol |
| SMILES | Clc1ccccc1Br.Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C6H4BrClO.C6H4BrCl/c7-5-3-4(8)1-2-6(5)9;7-5-3-1-2-4-6(5)8/h1-3,9H;1-4H |
| InChIKey | XUHZCSMNGNUDTL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol?
The IUPAC name of 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol (CID 175369538) is 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol.
What is the SMILES notation for 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol?
The canonical SMILES for 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol is Clc1ccccc1Br.Oc1ccc(Cl)cc1Br.
What is the InChIKey of 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol?
The InChIKey is XUHZCSMNGNUDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrClO.C6H4BrCl/c7-5-3-4(8)1-2-6(5)9;7-5-3-1-2-4-6(5)8/h1-3,9H;1-4H.
What are the key properties of 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol?
1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol has a molecular weight of 398.91 g/mol, XLogP of 5.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-chlorobenzene;2-bromo-4-chlorophenol is sourced from PubChem (CID 175369538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).