About 1-bromo-2-chlorobenzene;oxalonitrile
1-bromo-2-chlorobenzene;oxalonitrile (PubChem CID 174596541) has the molecular formula C8H4BrClN2
and a molecular weight of 243.49 g/mol. Its IUPAC name is 1-bromo-2-chlorobenzene;oxalonitrile.
Molecular Properties
| Compound Name | 1-bromo-2-chlorobenzene;oxalonitrile |
| PubChem CID | 174596541 |
| Molecular Formula | C8H4BrClN2 |
| Molecular Weight | 243.49 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | 1-bromo-2-chlorobenzene;oxalonitrile |
| SMILES | Clc1ccccc1Br.N#CC#N |
| InChI | InChI=1S/C6H4BrCl.C2N2/c7-5-3-1-2-4-6(5)8;3-1-2-4/h1-4H; |
| InChIKey | DDVAIJRSQFPGDC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-2-chlorobenzene;oxalonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-chlorobenzene;oxalonitrile?
The IUPAC name of 1-bromo-2-chlorobenzene;oxalonitrile (CID 174596541) is 1-bromo-2-chlorobenzene;oxalonitrile.
What is the SMILES notation for 1-bromo-2-chlorobenzene;oxalonitrile?
The canonical SMILES for 1-bromo-2-chlorobenzene;oxalonitrile is Clc1ccccc1Br.N#CC#N.
What is the InChIKey of 1-bromo-2-chlorobenzene;oxalonitrile?
The InChIKey is DDVAIJRSQFPGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrCl.C2N2/c7-5-3-1-2-4-6(5)8;3-1-2-4/h1-4H;.
What are the key properties of 1-bromo-2-chlorobenzene;oxalonitrile?
1-bromo-2-chlorobenzene;oxalonitrile has a molecular weight of 243.49 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-chlorobenzene;oxalonitrile is sourced from PubChem (CID 174596541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).