About 2-chlorobenzonitrile;hydron
2-chlorobenzonitrile;hydron (PubChem CID 131860473) has the molecular formula C7H5ClN+
and a molecular weight of 138.58 g/mol. Its IUPAC name is 2-chlorobenzonitrile;hydron.
Molecular Properties
| Compound Name | 2-chlorobenzonitrile;hydron |
| PubChem CID | 131860473 |
| Molecular Formula | C7H5ClN+ |
| Molecular Weight | 138.58 g/mol |
| Exact Mass | 138.01 |
| IUPAC Name | 2-chlorobenzonitrile;hydron |
| SMILES | N#Cc1ccccc1Cl.[H+] |
| InChI | InChI=1S/C7H4ClN/c8-7-4-2-1-3-6(7)5-9/h1-4H/p+1 |
| InChIKey | NHWQMJMIYICNBP-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chlorobenzonitrile;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzonitrile;hydron?
The IUPAC name of 2-chlorobenzonitrile;hydron (CID 131860473) is 2-chlorobenzonitrile;hydron.
What is the SMILES notation for 2-chlorobenzonitrile;hydron?
The canonical SMILES for 2-chlorobenzonitrile;hydron is N#Cc1ccccc1Cl.[H+].
What is the InChIKey of 2-chlorobenzonitrile;hydron?
The InChIKey is NHWQMJMIYICNBP-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H4ClN/c8-7-4-2-1-3-6(7)5-9/h1-4H/p+1.
What are the key properties of 2-chlorobenzonitrile;hydron?
2-chlorobenzonitrile;hydron has a molecular weight of 138.58 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzonitrile;hydron is sourced from PubChem (CID 131860473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).