About benzonitrile;2-chlorobenzonitrile
benzonitrile;2-chlorobenzonitrile (PubChem CID 158701743) has the molecular formula C14H9ClN2
and a molecular weight of 240.69 g/mol. Its IUPAC name is benzonitrile;2-chlorobenzonitrile.
Molecular Properties
| Compound Name | benzonitrile;2-chlorobenzonitrile |
| PubChem CID | 158701743 |
| Molecular Formula | C14H9ClN2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | benzonitrile;2-chlorobenzonitrile |
| SMILES | N#Cc1ccccc1.N#Cc1ccccc1Cl |
| InChI | InChI=1S/C7H4ClN.C7H5N/c8-7-4-2-1-3-6(7)5-9;8-6-7-4-2-1-3-5-7/h1-4H;1-5H |
| InChIKey | IHPYAAQVNNFQHJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzonitrile;2-chlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;2-chlorobenzonitrile?
The IUPAC name of benzonitrile;2-chlorobenzonitrile (CID 158701743) is benzonitrile;2-chlorobenzonitrile.
What is the SMILES notation for benzonitrile;2-chlorobenzonitrile?
The canonical SMILES for benzonitrile;2-chlorobenzonitrile is N#Cc1ccccc1.N#Cc1ccccc1Cl.
What is the InChIKey of benzonitrile;2-chlorobenzonitrile?
The InChIKey is IHPYAAQVNNFQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN.C7H5N/c8-7-4-2-1-3-6(7)5-9;8-6-7-4-2-1-3-5-7/h1-4H;1-5H.
What are the key properties of benzonitrile;2-chlorobenzonitrile?
benzonitrile;2-chlorobenzonitrile has a molecular weight of 240.69 g/mol, XLogP of 3.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;2-chlorobenzonitrile is sourced from PubChem (CID 158701743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).