About 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine
2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine (PubChem CID 161134756) has the molecular formula C16H14Cl2N2
and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine |
| PubChem CID | 161134756 |
| Molecular Formula | C16H14Cl2N2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine |
| SMILES | N#Cc1ccccc1Cl.NC1(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C9H10ClN.C7H4ClN/c10-8-4-2-1-3-7(8)9(11)5-6-9;8-7-4-2-1-3-6(7)5-9/h1-4H,5-6,11H2;1-4H |
| InChIKey | UMQLAJWTTCFAOL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine?
The IUPAC name of 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine (CID 161134756) is 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine.
What is the SMILES notation for 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine?
The canonical SMILES for 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine is N#Cc1ccccc1Cl.NC1(c2ccccc2Cl)CC1.
What is the InChIKey of 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine?
The InChIKey is UMQLAJWTTCFAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN.C7H4ClN/c10-8-4-2-1-3-7(8)9(11)5-6-9;8-7-4-2-1-3-6(7)5-9/h1-4H,5-6,11H2;1-4H.
What are the key properties of 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine?
2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine has a molecular weight of 305.21 g/mol, XLogP of 4.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzonitrile;1-(2-chlorophenyl)cyclopropan-1-amine is sourced from PubChem (CID 161134756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).