About 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile
6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile (PubChem CID 45120034) has the molecular formula C8H4ClNO
and a molecular weight of 165.58 g/mol. Its IUPAC name is 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile.
Analyze 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
The IUPAC name of 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile (CID 45120034) is 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile.
What is the SMILES notation for 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
The canonical SMILES for 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile is N#Cc1ccccc(Cl)c1=O.
What is the InChIKey of 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
The InChIKey is AMHLTWXHMJFYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClNO/c9-7-4-2-1-3-6(5-10)8(7)11/h1-4H.
What are the key properties of 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile?
6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile has a molecular weight of 165.58 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-oxocyclohepta-1,3,5-triene-1-carbonitrile is sourced from PubChem (CID 45120034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).