About benzene-1,2-dicarbonitrile;dihydrochloride
benzene-1,2-dicarbonitrile;dihydrochloride (PubChem CID 66675666) has the molecular formula C8H6Cl2N2
and a molecular weight of 201.06 g/mol. Its IUPAC name is benzene-1,2-dicarbonitrile;dihydrochloride.
Molecular Properties
| Compound Name | benzene-1,2-dicarbonitrile;dihydrochloride |
| PubChem CID | 66675666 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | benzene-1,2-dicarbonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1ccccc1C#N |
| InChI | InChI=1S/C8H4N2.2ClH/c9-5-7-3-1-2-4-8(7)6-10;;/h1-4H;2*1H |
| InChIKey | OABYYMFQSIKVLA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene-1,2-dicarbonitrile;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarbonitrile;dihydrochloride?
The IUPAC name of benzene-1,2-dicarbonitrile;dihydrochloride (CID 66675666) is benzene-1,2-dicarbonitrile;dihydrochloride.
What is the SMILES notation for benzene-1,2-dicarbonitrile;dihydrochloride?
The canonical SMILES for benzene-1,2-dicarbonitrile;dihydrochloride is Cl.Cl.N#Cc1ccccc1C#N.
What is the InChIKey of benzene-1,2-dicarbonitrile;dihydrochloride?
The InChIKey is OABYYMFQSIKVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2.2ClH/c9-5-7-3-1-2-4-8(7)6-10;;/h1-4H;2*1H.
What are the key properties of benzene-1,2-dicarbonitrile;dihydrochloride?
benzene-1,2-dicarbonitrile;dihydrochloride has a molecular weight of 201.06 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarbonitrile;dihydrochloride is sourced from PubChem (CID 66675666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).