C10H8N4O2 — CID 174519097
acetic acid;benzene-1,2-dicarbonitrile;molecular nitrogen (PubChem CID 174519097) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is acetic acid;benzene-1,2-dicarbonitrile;molecular nitrogen.
| Compound Name | acetic acid;benzene-1,2-dicarbonitrile;molecular nitrogen |
|---|---|
| PubChem CID | 174519097 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | acetic acid;benzene-1,2-dicarbonitrile;molecular nitrogen |
| SMILES | CC(=O)O.N#Cc1ccccc1C#N.N#N |
| InChI | InChI=1S/C8H4N2.C2H4O2.N2/c9-5-7-3-1-2-4-8(7)6-10;1-2(3)4;1-2/h1-4H;1H3,(H,3,4); |
| InChIKey | SSHKZXREHLYSFW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|