acetic acid;2,3-dichlorobenzonitrile

C9H7Cl2NO2 — CID 175302579

IUPACacetic acid;2,3-dichlorobenzonitrile
SMILESCC(=O)O.N#Cc1cccc(Cl)c1Cl
InChIInChI=1S/C7H3Cl2N.C2H4O2/c8-6-3-1-2-5(4-10)7(6)9;1-2(3)4/h1-3H;1H3,(H,3,4)
InChIKeyCCISTPJKMFGNHV-UHFFFAOYSA-N
MW232.07 g/mol
LogP2.96
Rot. Bonds

About acetic acid;2,3-dichlorobenzonitrile

acetic acid;2,3-dichlorobenzonitrile (PubChem CID 175302579) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is acetic acid;2,3-dichlorobenzonitrile.

Molecular Properties

Compound Nameacetic acid;2,3-dichlorobenzonitrile
PubChem CID175302579
Molecular FormulaC9H7Cl2NO2
Molecular Weight232.07 g/mol
Exact Mass230.99
IUPAC Nameacetic acid;2,3-dichlorobenzonitrile
SMILESCC(=O)O.N#Cc1cccc(Cl)c1Cl
InChIInChI=1S/C7H3Cl2N.C2H4O2/c8-6-3-1-2-5(4-10)7(6)9;1-2(3)4/h1-3H;1H3,(H,3,4)
InChIKeyCCISTPJKMFGNHV-UHFFFAOYSA-N
XLogP2.96
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.07
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze acetic acid;2,3-dichlorobenzonitrile with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2,3-dichlorobenzonitrile?
The IUPAC name of acetic acid;2,3-dichlorobenzonitrile (CID 175302579) is acetic acid;2,3-dichlorobenzonitrile.
What is the SMILES notation for acetic acid;2,3-dichlorobenzonitrile?
The canonical SMILES for acetic acid;2,3-dichlorobenzonitrile is CC(=O)O.N#Cc1cccc(Cl)c1Cl.
What is the InChIKey of acetic acid;2,3-dichlorobenzonitrile?
The InChIKey is CCISTPJKMFGNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2N.C2H4O2/c8-6-3-1-2-5(4-10)7(6)9;1-2(3)4/h1-3H;1H3,(H,3,4).
What are the key properties of acetic acid;2,3-dichlorobenzonitrile?
acetic acid;2,3-dichlorobenzonitrile has a molecular weight of 232.07 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2,3-dichlorobenzonitrile is sourced from PubChem (CID 175302579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).