C9H7Cl2NO2 — CID 175302579
acetic acid;2,3-dichlorobenzonitrile (PubChem CID 175302579) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is acetic acid;2,3-dichlorobenzonitrile.
| Compound Name | acetic acid;2,3-dichlorobenzonitrile |
|---|---|
| PubChem CID | 175302579 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | acetic acid;2,3-dichlorobenzonitrile |
| SMILES | CC(=O)O.N#Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl2N.C2H4O2/c8-6-3-1-2-5(4-10)7(6)9;1-2(3)4/h1-3H;1H3,(H,3,4) |
| InChIKey | CCISTPJKMFGNHV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |