C14H10Cl2N2O2 — CID 69021835
2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid (PubChem CID 69021835) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid.
| Compound Name | 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 69021835 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1cc(C#N)c(-c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N2O2/c1-8(14(19)20)18-6-9(5-17)11(7-18)10-3-2-4-12(15)13(10)16/h2-4,6-8H,1H3,(H,19,20) |
| InChIKey | IVXFHOHNKQSQFF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |