2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid

C14H10Cl2N2O2 — CID 69021835

IUPAC2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid
SMILESCC(C(=O)O)n1cc(C#N)c(-c2cccc(Cl)c2Cl)c1
InChIInChI=1S/C14H10Cl2N2O2/c1-8(14(19)20)18-6-9(5-17)11(7-18)10-3-2-4-12(15)13(10)16/h2-4,6-8H,1H3,(H,19,20)
InChIKeyIVXFHOHNKQSQFF-UHFFFAOYSA-N
MW309.15 g/mol
LogP3.98
Rot. Bonds3

About 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid

2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid (PubChem CID 69021835) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid.

Molecular Properties

Compound Name2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid
PubChem CID69021835
Molecular FormulaC14H10Cl2N2O2
Molecular Weight309.15 g/mol
Exact Mass308.01
IUPAC Name2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid
SMILESCC(C(=O)O)n1cc(C#N)c(-c2cccc(Cl)c2Cl)c1
InChIInChI=1S/C14H10Cl2N2O2/c1-8(14(19)20)18-6-9(5-17)11(7-18)10-3-2-4-12(15)13(10)16/h2-4,6-8H,1H3,(H,19,20)
InChIKeyIVXFHOHNKQSQFF-UHFFFAOYSA-N
XLogP3.98
TPSA66.02 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.15
LogP ≤ 53.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid?
The IUPAC name of 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid (CID 69021835) is 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid.
What is the SMILES notation for 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid?
The canonical SMILES for 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid is CC(C(=O)O)n1cc(C#N)c(-c2cccc(Cl)c2Cl)c1.
What is the InChIKey of 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid?
The InChIKey is IVXFHOHNKQSQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2O2/c1-8(14(19)20)18-6-9(5-17)11(7-18)10-3-2-4-12(15)13(10)16/h2-4,6-8H,1H3,(H,19,20).
What are the key properties of 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid?
2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid has a molecular weight of 309.15 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-cyano-4-(2,3-dichlorophenyl)pyrrol-1-yl]propanoic acid is sourced from PubChem (CID 69021835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).