C9H10Cl2O4 — CID 163936283
2,3-dichlorophenol;2-hydroxypropanoic acid (PubChem CID 163936283) has the molecular formula C9H10Cl2O4 and a molecular weight of 253.08 g/mol. Its IUPAC name is 2,3-dichlorophenol;2-hydroxypropanoic acid.
| Compound Name | 2,3-dichlorophenol;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 163936283 |
| Molecular Formula | C9H10Cl2O4 |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2,3-dichlorophenol;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C6H4Cl2O.C3H6O3/c7-4-2-1-3-5(9)6(4)8;1-2(4)3(5)6/h1-3,9H;2,4H,1H3,(H,5,6) |
| InChIKey | RNCJEQCFMSAXFD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |