2,3-dichlorophenol;2-hydroxypropanoic acid

C9H10Cl2O4 — CID 163936283

IUPAC2,3-dichlorophenol;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.Oc1cccc(Cl)c1Cl
InChIInChI=1S/C6H4Cl2O.C3H6O3/c7-4-2-1-3-5(9)6(4)8;1-2(4)3(5)6/h1-3,9H;2,4H,1H3,(H,5,6)
InChIKeyRNCJEQCFMSAXFD-UHFFFAOYSA-N
MW253.08 g/mol
LogP2.15
Rot. Bonds1

About 2,3-dichlorophenol;2-hydroxypropanoic acid

2,3-dichlorophenol;2-hydroxypropanoic acid (PubChem CID 163936283) has the molecular formula C9H10Cl2O4 and a molecular weight of 253.08 g/mol. Its IUPAC name is 2,3-dichlorophenol;2-hydroxypropanoic acid.

Molecular Properties

Compound Name2,3-dichlorophenol;2-hydroxypropanoic acid
PubChem CID163936283
Molecular FormulaC9H10Cl2O4
Molecular Weight253.08 g/mol
Exact Mass252.00
IUPAC Name2,3-dichlorophenol;2-hydroxypropanoic acid
SMILESCC(O)C(=O)O.Oc1cccc(Cl)c1Cl
InChIInChI=1S/C6H4Cl2O.C3H6O3/c7-4-2-1-3-5(9)6(4)8;1-2(4)3(5)6/h1-3,9H;2,4H,1H3,(H,5,6)
InChIKeyRNCJEQCFMSAXFD-UHFFFAOYSA-N
XLogP2.15
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.08
LogP ≤ 52.15
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,3-dichlorophenol;2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dichlorophenol;2-hydroxypropanoic acid?
The IUPAC name of 2,3-dichlorophenol;2-hydroxypropanoic acid (CID 163936283) is 2,3-dichlorophenol;2-hydroxypropanoic acid.
What is the SMILES notation for 2,3-dichlorophenol;2-hydroxypropanoic acid?
The canonical SMILES for 2,3-dichlorophenol;2-hydroxypropanoic acid is CC(O)C(=O)O.Oc1cccc(Cl)c1Cl.
What is the InChIKey of 2,3-dichlorophenol;2-hydroxypropanoic acid?
The InChIKey is RNCJEQCFMSAXFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2O.C3H6O3/c7-4-2-1-3-5(9)6(4)8;1-2(4)3(5)6/h1-3,9H;2,4H,1H3,(H,5,6).
What are the key properties of 2,3-dichlorophenol;2-hydroxypropanoic acid?
2,3-dichlorophenol;2-hydroxypropanoic acid has a molecular weight of 253.08 g/mol, XLogP of 2.15, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichlorophenol;2-hydroxypropanoic acid is sourced from PubChem (CID 163936283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).