C12H12Cl2O3 — CID 79415015
4-(2,6-dichlorophenyl)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 79415015) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(2,6-dichlorophenyl)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79415015 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H12Cl2O3/c1-6(7(2)12(16)17)11(15)10-8(13)4-3-5-9(10)14/h3-7H,1-2H3,(H,16,17) |
| InChIKey | RGMPVDCTFGSWNQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |